C8H15NO3S — CID 131154644
(3-ethylsulfonyl-3-azabicyclo[3.1.0]hexan-1-yl)methanol (PubChem CID 131154644) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is (3-ethylsulfonyl-3-azabicyclo[3.1.0]hexan-1-yl)methanol.
| Compound Name | (3-ethylsulfonyl-3-azabicyclo[3.1.0]hexan-1-yl)methanol |
|---|---|
| PubChem CID | 131154644 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | (3-ethylsulfonyl-3-azabicyclo[3.1.0]hexan-1-yl)methanol |
| SMILES | CCS(=O)(=O)N1CC2CC2(CO)C1 |
| InChI | InChI=1S/C8H15NO3S/c1-2-13(11,12)9-4-7-3-8(7,5-9)6-10/h7,10H,2-6H2,1H3 |
| InChIKey | SVCZWIGVVLZRCJ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |