C7H11ClN4 — CID 131197654
N'-(5-chloropyrazin-2-yl)propane-1,3-diamine (PubChem CID 131197654) has the molecular formula C7H11ClN4 and a molecular weight of 186.65 g/mol. Its IUPAC name is N'-(5-chloropyrazin-2-yl)propane-1,3-diamine.
| Compound Name | N'-(5-chloropyrazin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 131197654 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | N'-(5-chloropyrazin-2-yl)propane-1,3-diamine |
| SMILES | NCCCNc1cnc(Cl)cn1 |
| InChI | InChI=1S/C7H11ClN4/c8-6-4-12-7(5-11-6)10-3-1-2-9/h4-5H,1-3,9H2,(H,10,12) |
| InChIKey | RJSALEVCJDJBGZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|