About 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile
2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile (PubChem CID 13127504) has the molecular formula C12H10Cl2N4
and a molecular weight of 281.15 g/mol. Its IUPAC name is 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile |
| PubChem CID | 13127504 |
| Molecular Formula | C12H10Cl2N4 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile |
| SMILES | CCc1ccc(NNC=C(C#N)C#N)c(Cl)c1Cl |
| InChI | InChI=1S/C12H10Cl2N4/c1-2-9-3-4-10(12(14)11(9)13)18-17-7-8(5-15)6-16/h3-4,7,17-18H,2H2,1H3 |
| InChIKey | JADRUDDSQZOIOX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile?
The IUPAC name of 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile (CID 13127504) is 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile.
What is the SMILES notation for 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile?
The canonical SMILES for 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile is CCc1ccc(NNC=C(C#N)C#N)c(Cl)c1Cl.
What is the InChIKey of 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile?
The InChIKey is JADRUDDSQZOIOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N4/c1-2-9-3-4-10(12(14)11(9)13)18-17-7-8(5-15)6-16/h3-4,7,17-18H,2H2,1H3.
What are the key properties of 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile?
2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile has a molecular weight of 281.15 g/mol, XLogP of 3.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2,3-dichloro-4-ethylphenyl)hydrazinyl]methylidene]propanedinitrile is sourced from PubChem (CID 13127504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).