C16H13Cl3N4O3 — CID 13127637
methyl N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]-N-(2-methylpropanoyl)carbamate (PubChem CID 13127637) has the molecular formula C16H13Cl3N4O3 and a molecular weight of 415.66 g/mol. Its IUPAC name is methyl N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]-N-(2-methylpropanoyl)carbamate.
| Compound Name | methyl N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]-N-(2-methylpropanoyl)carbamate |
|---|---|
| PubChem CID | 13127637 |
| Molecular Formula | C16H13Cl3N4O3 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | methyl N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]-N-(2-methylpropanoyl)carbamate |
| SMILES | COC(=O)N(C(=O)C(C)C)c1c(C#N)cnn1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H13Cl3N4O3/c1-8(2)15(24)22(16(25)26-3)14-9(6-20)7-21-23(14)11-5-4-10(17)12(18)13(11)19/h4-5,7-8H,1-3H3 |
| InChIKey | SHFMJCUHWQKDJY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|