C15H15Cl3N4 — CID 70523378
5-(3-methylbutylamino)-1-(2,3,4-trichlorophenyl)pyrazole-4-carbonitrile (PubChem CID 70523378) has the molecular formula C15H15Cl3N4 and a molecular weight of 357.67 g/mol. Its IUPAC name is 5-(3-methylbutylamino)-1-(2,3,4-trichlorophenyl)pyrazole-4-carbonitrile.
| Compound Name | 5-(3-methylbutylamino)-1-(2,3,4-trichlorophenyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 70523378 |
| Molecular Formula | C15H15Cl3N4 |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 5-(3-methylbutylamino)-1-(2,3,4-trichlorophenyl)pyrazole-4-carbonitrile |
| SMILES | CC(C)CCNc1c(C#N)cnn1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H15Cl3N4/c1-9(2)5-6-20-15-10(7-19)8-21-22(15)12-4-3-11(16)13(17)14(12)18/h3-4,8-9,20H,5-6H2,1-2H3 |
| InChIKey | APAKSEVKADMWGJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|