C15H12Cl4N4O — CID 13127641
4-chloro-N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]pentanamide (PubChem CID 13127641) has the molecular formula C15H12Cl4N4O and a molecular weight of 406.10 g/mol. Its IUPAC name is 4-chloro-N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]pentanamide.
| Compound Name | 4-chloro-N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]pentanamide |
|---|---|
| PubChem CID | 13127641 |
| Molecular Formula | C15H12Cl4N4O |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | 4-chloro-N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]pentanamide |
| SMILES | CC(Cl)CCC(=O)Nc1c(C#N)cnn1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H12Cl4N4O/c1-8(16)2-5-12(24)22-15-9(6-20)7-21-23(15)11-4-3-10(17)13(18)14(11)19/h3-4,7-8H,2,5H2,1H3,(H,22,24) |
| InChIKey | DFKSJJQXNSBRRU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|