C16H15Cl3N4O — CID 13281467
N-butan-2-yl-N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]acetamide (PubChem CID 13281467) has the molecular formula C16H15Cl3N4O and a molecular weight of 385.68 g/mol. Its IUPAC name is N-butan-2-yl-N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]acetamide.
| Compound Name | N-butan-2-yl-N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 13281467 |
| Molecular Formula | C16H15Cl3N4O |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | N-butan-2-yl-N-[4-cyano-1-(2,3,4-trichlorophenyl)pyrazol-5-yl]acetamide |
| SMILES | CCC(C)N(C(C)=O)c1c(C#N)cnn1-c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H15Cl3N4O/c1-4-9(2)22(10(3)24)16-11(7-20)8-21-23(16)13-6-5-12(17)14(18)15(13)19/h5-6,8-9H,4H2,1-3H3 |
| InChIKey | COZSLTQQOGIRRG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|