C14H7Cl3N4O2 — CID 54503987
5-(2,5-dihydroxypyrrol-1-yl)-1-(2,3,4-trichlorophenyl)pyrazole-4-carbonitrile (PubChem CID 54503987) has the molecular formula C14H7Cl3N4O2 and a molecular weight of 369.60 g/mol. Its IUPAC name is 5-(2,5-dihydroxypyrrol-1-yl)-1-(2,3,4-trichlorophenyl)pyrazole-4-carbonitrile.
| Compound Name | 5-(2,5-dihydroxypyrrol-1-yl)-1-(2,3,4-trichlorophenyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 54503987 |
| Molecular Formula | C14H7Cl3N4O2 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 5-(2,5-dihydroxypyrrol-1-yl)-1-(2,3,4-trichlorophenyl)pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(-c2ccc(Cl)c(Cl)c2Cl)c1-n1c(O)ccc1O |
| InChI | InChI=1S/C14H7Cl3N4O2/c15-8-1-2-9(13(17)12(8)16)21-14(7(5-18)6-19-21)20-10(22)3-4-11(20)23/h1-4,6,22-23H |
| InChIKey | YEKMCJDQMXYRJN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|