C16H13N3OS — CID 13131302
N-(2-methyl-5-phenyl-1,2,4-thiadiazol-3-ylidene)benzamide (PubChem CID 13131302) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is N-(2-methyl-5-phenyl-1,2,4-thiadiazol-3-ylidene)benzamide.
| Compound Name | N-(2-methyl-5-phenyl-1,2,4-thiadiazol-3-ylidene)benzamide |
|---|---|
| PubChem CID | 13131302 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-(2-methyl-5-phenyl-1,2,4-thiadiazol-3-ylidene)benzamide |
| SMILES | Cn1sc(-c2ccccc2)n/c1=N\C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13N3OS/c1-19-16(17-14(20)12-8-4-2-5-9-12)18-15(21-19)13-10-6-3-7-11-13/h2-11H,1H3/b17-16+ |
| InChIKey | HHHASISNIQUCLY-WUKNDPDISA-N |
| XLogP | 2.89 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |