C10H11N3O2 — CID 13133639
2-benzyl-1,2,4-triazinane-3,6-dione (PubChem CID 13133639) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-benzyl-1,2,4-triazinane-3,6-dione.
| Compound Name | 2-benzyl-1,2,4-triazinane-3,6-dione |
|---|---|
| PubChem CID | 13133639 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-benzyl-1,2,4-triazinane-3,6-dione |
| SMILES | O=C1CNC(=O)N(Cc2ccccc2)N1 |
| InChI | InChI=1S/C10H11N3O2/c14-9-6-11-10(15)13(12-9)7-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,15)(H,12,14) |
| InChIKey | UKJZDZVPCXKNFL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |