C18H22N2O3 — CID 13145308
3-[(3,4-dimethoxyphenyl)methyl]-2-methyl-5,6,7,8-tetrahydrocinnolin-2-ium-4-olate (PubChem CID 13145308) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-2-methyl-5,6,7,8-tetrahydrocinnolin-2-ium-4-olate.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-2-methyl-5,6,7,8-tetrahydrocinnolin-2-ium-4-olate |
|---|---|
| PubChem CID | 13145308 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-2-methyl-5,6,7,8-tetrahydrocinnolin-2-ium-4-olate |
| SMILES | COc1ccc(Cc2c([O-])c3c(n[n+]2C)CCCC3)cc1OC |
| InChI | InChI=1S/C18H22N2O3/c1-20-15(18(21)13-6-4-5-7-14(13)19-20)10-12-8-9-16(22-2)17(11-12)23-3/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | NWJFGQQOJQIXHT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|