C17H28NO8P — CID 13154119
ethyl N-(2,2-dimethoxyethyl)-N-[dimethoxyphosphoryl-(4-methoxyphenyl)methyl]carbamate (PubChem CID 13154119) has the molecular formula C17H28NO8P and a molecular weight of 405.38 g/mol. Its IUPAC name is ethyl N-(2,2-dimethoxyethyl)-N-[dimethoxyphosphoryl-(4-methoxyphenyl)methyl]carbamate.
| Compound Name | ethyl N-(2,2-dimethoxyethyl)-N-[dimethoxyphosphoryl-(4-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 13154119 |
| Molecular Formula | C17H28NO8P |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | ethyl N-(2,2-dimethoxyethyl)-N-[dimethoxyphosphoryl-(4-methoxyphenyl)methyl]carbamate |
| SMILES | CCOC(=O)N(CC(OC)OC)C(c1ccc(OC)cc1)P(=O)(OC)OC |
| InChI | InChI=1S/C17H28NO8P/c1-7-26-17(19)18(12-15(22-3)23-4)16(27(20,24-5)25-6)13-8-10-14(21-2)11-9-13/h8-11,15-16H,7,12H2,1-6H3 |
| InChIKey | QZYFPBHKLOJVKO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|