C22H15ClN2OS — CID 13162445
(5-anilino-2-phenyl-1,3-thiazol-4-yl)-(4-chlorophenyl)methanone (PubChem CID 13162445) has the molecular formula C22H15ClN2OS and a molecular weight of 390.90 g/mol. Its IUPAC name is (5-anilino-2-phenyl-1,3-thiazol-4-yl)-(4-chlorophenyl)methanone.
| Compound Name | (5-anilino-2-phenyl-1,3-thiazol-4-yl)-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 13162445 |
| Molecular Formula | C22H15ClN2OS |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | (5-anilino-2-phenyl-1,3-thiazol-4-yl)-(4-chlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)c1nc(-c2ccccc2)sc1Nc1ccccc1 |
| InChI | InChI=1S/C22H15ClN2OS/c23-17-13-11-15(12-14-17)20(26)19-22(24-18-9-5-2-6-10-18)27-21(25-19)16-7-3-1-4-8-16/h1-14,24H |
| InChIKey | UHGXKFZYUDTVTG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |