C16H11ClN2OSe — CID 177471312
[5-(4-chloroanilino)-1,3-selenazol-4-yl]-phenylmethanone (PubChem CID 177471312) has the molecular formula C16H11ClN2OSe and a molecular weight of 361.69 g/mol. Its IUPAC name is [5-(4-chloroanilino)-1,3-selenazol-4-yl]-phenylmethanone.
| Compound Name | [5-(4-chloroanilino)-1,3-selenazol-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 177471312 |
| Molecular Formula | C16H11ClN2OSe |
| Molecular Weight | 361.69 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | [5-(4-chloroanilino)-1,3-selenazol-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1nc[se]c1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClN2OSe/c17-12-6-8-13(9-7-12)19-16-14(18-10-21-16)15(20)11-4-2-1-3-5-11/h1-10,19H |
| InChIKey | WSXNXPPXMZJREW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.69 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|