C21H24N2O3 — CID 131680699
[(3R,3aS,6aS)-3-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-phenylmethanone (PubChem CID 131680699) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(3R,3aS,6aS)-3-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-phenylmethanone.
| Compound Name | [(3R,3aS,6aS)-3-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 131680699 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [(3R,3aS,6aS)-3-[(2,6-dimethyl-4-pyridinyl)oxymethyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-phenylmethanone |
| SMILES | Cc1cc(OC[C@H]2CO[C@@H]3CN(C(=O)c4ccccc4)C[C@H]23)cc(C)n1 |
| InChI | InChI=1S/C21H24N2O3/c1-14-8-18(9-15(2)22-14)25-12-17-13-26-20-11-23(10-19(17)20)21(24)16-6-4-3-5-7-16/h3-9,17,19-20H,10-13H2,1-2H3/t17-,19+,20+/m0/s1 |
| InChIKey | FRPPTLSFEPMKHP-DFQSSKMNSA-N |
| XLogP | 2.86 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |