C20H32ClNO4 — CID 131713075
3-hydroxy-3-[[4-(2-methylpropyl)phenyl]-(trimethylazaniumyl)methyl]-4-oxohexanoate;hydrochloride (PubChem CID 131713075) has the molecular formula C20H32ClNO4 and a molecular weight of 385.93 g/mol. Its IUPAC name is 3-hydroxy-3-[[4-(2-methylpropyl)phenyl]-(trimethylazaniumyl)methyl]-4-oxohexanoate;hydrochloride.
| Compound Name | 3-hydroxy-3-[[4-(2-methylpropyl)phenyl]-(trimethylazaniumyl)methyl]-4-oxohexanoate;hydrochloride |
|---|---|
| PubChem CID | 131713075 |
| Molecular Formula | C20H32ClNO4 |
| Molecular Weight | 385.93 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-hydroxy-3-[[4-(2-methylpropyl)phenyl]-(trimethylazaniumyl)methyl]-4-oxohexanoate;hydrochloride |
| SMILES | CCC(=O)C(O)(CC(=O)[O-])C(c1ccc(CC(C)C)cc1)[N+](C)(C)C.Cl |
| InChI | InChI=1S/C20H31NO4.ClH/c1-7-17(22)20(25,13-18(23)24)19(21(4,5)6)16-10-8-15(9-11-16)12-14(2)3;/h8-11,14,19,25H,7,12-13H2,1-6H3;1H |
| InChIKey | VLHDAUHGRWBTHP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.93 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|