C28H39NO5Si — CID 131726275
tert-butyl (2S,4S)-4-acetyloxy-2-tert-butyl-3,3-diphenyl-2-(silyloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 131726275) has the molecular formula C28H39NO5Si and a molecular weight of 497.71 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-acetyloxy-2-tert-butyl-3,3-diphenyl-2-(silyloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-acetyloxy-2-tert-butyl-3,3-diphenyl-2-(silyloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 131726275 |
| Molecular Formula | C28H39NO5Si |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | tert-butyl (2S,4S)-4-acetyloxy-2-tert-butyl-3,3-diphenyl-2-(silyloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)O[C@@H]1CN(C(=O)OC(C)(C)C)[C@@](CO[SiH3])(C(C)(C)C)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H39NO5Si/c1-20(30)33-23-18-29(24(31)34-26(5,6)7)27(19-32-35,25(2,3)4)28(23,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,23H,18-19H2,1-7,35H3/t23-,27+/m1/s1 |
| InChIKey | DXEMACQERGKBPT-KCWPFWIISA-N |
| XLogP | 4.24 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|