C21H30N2O2 — CID 175286525
tert-butyl 2,3-dicyclopropyl-2-phenylpiperazine-1-carboxylate (PubChem CID 175286525) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is tert-butyl 2,3-dicyclopropyl-2-phenylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 2,3-dicyclopropyl-2-phenylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175286525 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | tert-butyl 2,3-dicyclopropyl-2-phenylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C2CC2)C1(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C21H30N2O2/c1-20(2,3)25-19(24)23-14-13-22-18(15-9-10-15)21(23,17-11-12-17)16-7-5-4-6-8-16/h4-8,15,17-18,22H,9-14H2,1-3H3 |
| InChIKey | WDMPYXJTXWXGIT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |