C29H30F3NO5S — CID 131740125
tert-butyl 1,1-dioxo-2-[[3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]phenyl]methyl]thiazinane-3-carboxylate (PubChem CID 131740125) has the molecular formula C29H30F3NO5S and a molecular weight of 561.62 g/mol. Its IUPAC name is tert-butyl 1,1-dioxo-2-[[3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]phenyl]methyl]thiazinane-3-carboxylate.
| Compound Name | tert-butyl 1,1-dioxo-2-[[3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]phenyl]methyl]thiazinane-3-carboxylate |
|---|---|
| PubChem CID | 131740125 |
| Molecular Formula | C29H30F3NO5S |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | tert-butyl 1,1-dioxo-2-[[3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]phenyl]methyl]thiazinane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCS(=O)(=O)N1Cc1cccc(COc2ccc(-c3cc(F)c(F)cc3F)cc2)c1 |
| InChI | InChI=1S/C29H30F3NO5S/c1-29(2,3)38-28(34)27-8-5-13-39(35,36)33(27)17-19-6-4-7-20(14-19)18-37-22-11-9-21(10-12-22)23-15-25(31)26(32)16-24(23)30/h4,6-7,9-12,14-16,27H,5,8,13,17-18H2,1-3H3 |
| InChIKey | DGVFZBPTMIZLOR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|