C22H36O3Si — CID 131745275
(3R,4S,5S)-3-benzyl-5-methyl-4-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one (PubChem CID 131745275) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is (3R,4S,5S)-3-benzyl-5-methyl-4-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one.
| Compound Name | (3R,4S,5S)-3-benzyl-5-methyl-4-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 131745275 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (3R,4S,5S)-3-benzyl-5-methyl-4-[tri(propan-2-yl)silyloxymethyl]oxolan-2-one |
| SMILES | CC(C)[Si](OC[C@H]1[C@H](C)OC(=O)[C@@H]1Cc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H36O3Si/c1-15(2)26(16(3)4,17(5)6)24-14-21-18(7)25-22(23)20(21)13-19-11-9-8-10-12-19/h8-12,15-18,20-21H,13-14H2,1-7H3/t18-,20+,21-/m0/s1 |
| InChIKey | VGOYLVMASUFENL-TYPHKJRUSA-N |
| XLogP | 5.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|