C8H11N — CID 131855311
3-methyl-2-azabicyclo[2.2.2]octa-2,5-diene (PubChem CID 131855311) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 3-methyl-2-azabicyclo[2.2.2]octa-2,5-diene.
| Compound Name | 3-methyl-2-azabicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 131855311 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 3-methyl-2-azabicyclo[2.2.2]octa-2,5-diene |
| SMILES | CC1=NC2C=CC1CC2 |
| InChI | InChI=1S/C8H11N/c1-6-7-2-4-8(9-6)5-3-7/h2,4,7-8H,3,5H2,1H3 |
| InChIKey | PLQOSFTXPLPZPT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|