C11H16N2O2 — CID 131861700
7-pentyl-1H-1,3-diazocine-2,4-dione (PubChem CID 131861700) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 7-pentyl-1H-1,3-diazocine-2,4-dione.
| Compound Name | 7-pentyl-1H-1,3-diazocine-2,4-dione |
|---|---|
| PubChem CID | 131861700 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 7-pentyl-1H-1,3-diazocine-2,4-dione |
| SMILES | CCCCCC1=CNC(=O)NC(=O)C=C1 |
| InChI | InChI=1S/C11H16N2O2/c1-2-3-4-5-9-6-7-10(14)13-11(15)12-8-9/h6-8H,2-5H2,1H3,(H2,12,13,14,15) |
| InChIKey | RFLAXOXXPUUXFC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|