C24H28N8 — CID 5384324
(2Z,6Z,9Z,13Z)-6,13-dipentyl-1,4,8,11-tetrazacyclotetradeca-2,4,6,9,11,13-hexaene-2,3,9,10-tetracarbonitrile (PubChem CID 5384324) has the molecular formula C24H28N8 and a molecular weight of 428.54 g/mol. Its IUPAC name is (2Z,6Z,9Z,13Z)-6,13-dipentyl-1,4,8,11-tetrazacyclotetradeca-2,4,6,9,11,13-hexaene-2,3,9,10-tetracarbonitrile.
| Compound Name | (2Z,6Z,9Z,13Z)-6,13-dipentyl-1,4,8,11-tetrazacyclotetradeca-2,4,6,9,11,13-hexaene-2,3,9,10-tetracarbonitrile |
|---|---|
| PubChem CID | 5384324 |
| Molecular Formula | C24H28N8 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (2Z,6Z,9Z,13Z)-6,13-dipentyl-1,4,8,11-tetrazacyclotetradeca-2,4,6,9,11,13-hexaene-2,3,9,10-tetracarbonitrile |
| SMILES | CCCCCC1=C/N/C(C#N)=C(C#N)\N=C\C(CCCCC)=C/N/C(C#N)=C(C#N)\N=C\1 |
| InChI | InChI=1S/C24H28N8/c1-3-5-7-9-19-15-29-21(11-25)23(13-27)31-17-20(10-8-6-4-2)18-32-24(14-28)22(12-26)30-16-19/h15-18,29,32H,3-10H2,1-2H3/b19-15-,20-18-,23-21-,24-22-,30-16+,31-17+ |
| InChIKey | AYOVVMQLHWDGJC-JYJMEXIDSA-N |
| XLogP | 4.77 |
| TPSA | 143.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|