About perchloric acid;zinc
perchloric acid;zinc (PubChem CID 131873013) has the molecular formula H2Cl2O8Zn
and a molecular weight of 266.30 g/mol. Its IUPAC name is perchloric acid;zinc.
Molecular Properties
| Compound Name | perchloric acid;zinc |
| PubChem CID | 131873013 |
| Molecular Formula | H2Cl2O8Zn |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 263.84 |
| IUPAC Name | perchloric acid;zinc |
| SMILES | [O-][Cl+3]([O-])([O-])O.[O-][Cl+3]([O-])([O-])O.[Zn] |
| InChI | InChI=1S/2ClHO4.Zn/c2*2-1(3,4)5;/h2*(H,2,3,4,5); |
| InChIKey | SHFUAMLTTNTFGW-UHFFFAOYSA-N |
| XLogP | -8.25 |
| TPSA | 178.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze perchloric acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perchloric acid;zinc?
The IUPAC name of perchloric acid;zinc (CID 131873013) is perchloric acid;zinc.
What is the SMILES notation for perchloric acid;zinc?
The canonical SMILES for perchloric acid;zinc is [O-][Cl+3]([O-])([O-])O.[O-][Cl+3]([O-])([O-])O.[Zn].
What is the InChIKey of perchloric acid;zinc?
The InChIKey is SHFUAMLTTNTFGW-UHFFFAOYSA-N. The full InChI is InChI=1S/2ClHO4.Zn/c2*2-1(3,4)5;/h2*(H,2,3,4,5);.
What are the key properties of perchloric acid;zinc?
perchloric acid;zinc has a molecular weight of 266.30 g/mol, XLogP of -8.25, 0 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for perchloric acid;zinc is sourced from PubChem (CID 131873013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).