C18H24N4O2 — CID 131924683
N-(2,3-dimethylphenyl)-N'-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]propanediamide (PubChem CID 131924683) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N'-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]propanediamide.
| Compound Name | N-(2,3-dimethylphenyl)-N'-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]propanediamide |
|---|---|
| PubChem CID | 131924683 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N'-[1-(5-methyl-1H-pyrazol-3-yl)propan-2-yl]propanediamide |
| SMILES | Cc1cc(CC(C)NC(=O)CC(=O)Nc2cccc(C)c2C)n[nH]1 |
| InChI | InChI=1S/C18H24N4O2/c1-11-6-5-7-16(14(11)4)20-18(24)10-17(23)19-12(2)8-15-9-13(3)21-22-15/h5-7,9,12H,8,10H2,1-4H3,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | ALICATKUDRQBSK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|