C23H29NS — CID 131989294
N-ethyl-2-(4-phenylsulfanylphenyl)non-1-en-3-imine (PubChem CID 131989294) has the molecular formula C23H29NS and a molecular weight of 351.56 g/mol. Its IUPAC name is N-ethyl-2-(4-phenylsulfanylphenyl)non-1-en-3-imine.
| Compound Name | N-ethyl-2-(4-phenylsulfanylphenyl)non-1-en-3-imine |
|---|---|
| PubChem CID | 131989294 |
| Molecular Formula | C23H29NS |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-ethyl-2-(4-phenylsulfanylphenyl)non-1-en-3-imine |
| SMILES | C=C(/C(CCCCCC)=N/CC)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C23H29NS/c1-4-6-7-11-14-23(24-5-2)19(3)20-15-17-22(18-16-20)25-21-12-9-8-10-13-21/h8-10,12-13,15-18H,3-7,11,14H2,1-2H3/b24-23+ |
| InChIKey | MRZUHUFNOQHQKC-WCWDXBQESA-N |
| XLogP | 7.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|