C28H33NO4 — CID 131991680
cyclooctyl (E)-5-(9H-fluoren-9-ylmethoxycarbonylamino)pent-3-enoate (PubChem CID 131991680) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is cyclooctyl (E)-5-(9H-fluoren-9-ylmethoxycarbonylamino)pent-3-enoate.
| Compound Name | cyclooctyl (E)-5-(9H-fluoren-9-ylmethoxycarbonylamino)pent-3-enoate |
|---|---|
| PubChem CID | 131991680 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | cyclooctyl (E)-5-(9H-fluoren-9-ylmethoxycarbonylamino)pent-3-enoate |
| SMILES | O=C(C/C=C/CNC(=O)OCC1c2ccccc2-c2ccccc21)OC1CCCCCCC1 |
| InChI | InChI=1S/C28H33NO4/c30-27(33-21-12-4-2-1-3-5-13-21)18-10-11-19-29-28(31)32-20-26-24-16-8-6-14-22(24)23-15-7-9-17-25(23)26/h6-11,14-17,21,26H,1-5,12-13,18-20H2,(H,29,31)/b11-10+ |
| InChIKey | UNNMUEGAJOVZCK-ZHACJKMWSA-N |
| XLogP | 6.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|