C20H29N5O5 — CID 131993392
methyl 2-[[2-[(2-aminooxyacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(methylamino)pentanoate (PubChem CID 131993392) has the molecular formula C20H29N5O5 and a molecular weight of 419.48 g/mol. Its IUPAC name is methyl 2-[[2-[(2-aminooxyacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(methylamino)pentanoate.
| Compound Name | methyl 2-[[2-[(2-aminooxyacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(methylamino)pentanoate |
|---|---|
| PubChem CID | 131993392 |
| Molecular Formula | C20H29N5O5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | methyl 2-[[2-[(2-aminooxyacetyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-5-(methylamino)pentanoate |
| SMILES | CNCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CON)C(=O)OC |
| InChI | InChI=1S/C20H29N5O5/c1-22-9-5-8-16(20(28)29-2)25-19(27)17(24-18(26)12-30-21)10-13-11-23-15-7-4-3-6-14(13)15/h3-4,6-7,11,16-17,22-23H,5,8-10,12,21H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | LORGZAGSDSHXKZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 147.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|