C20H33ClN2O4 — CID 131997204
(E,4E)-4-[(Z)-2-chloropent-2-enylidene]-N'-(4,4-diethoxybutyl)-N,2-dimethylpent-2-enediamide (PubChem CID 131997204) has the molecular formula C20H33ClN2O4 and a molecular weight of 400.95 g/mol. Its IUPAC name is (E,4E)-4-[(Z)-2-chloropent-2-enylidene]-N'-(4,4-diethoxybutyl)-N,2-dimethylpent-2-enediamide.
| Compound Name | (E,4E)-4-[(Z)-2-chloropent-2-enylidene]-N'-(4,4-diethoxybutyl)-N,2-dimethylpent-2-enediamide |
|---|---|
| PubChem CID | 131997204 |
| Molecular Formula | C20H33ClN2O4 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (E,4E)-4-[(Z)-2-chloropent-2-enylidene]-N'-(4,4-diethoxybutyl)-N,2-dimethylpent-2-enediamide |
| SMILES | CC/C=C(Cl)/C=C(\C=C(/C)C(=O)NC)C(=O)NCCCC(OCC)OCC |
| InChI | InChI=1S/C20H33ClN2O4/c1-6-10-17(21)14-16(13-15(4)19(24)22-5)20(25)23-12-9-11-18(26-7-2)27-8-3/h10,13-14,18H,6-9,11-12H2,1-5H3,(H,22,24)(H,23,25)/b15-13+,16-14+,17-10- |
| InChIKey | NSXIGWTVBNIWAZ-OEWFZWQESA-N |
| XLogP | 3.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|