C16H20F3IO2 — CID 132503968
1-methoxy-4-[[(E)-7,7,7-trifluoro-6-iodo-2-methylhept-5-en-3-yl]oxymethyl]benzene (PubChem CID 132503968) has the molecular formula C16H20F3IO2 and a molecular weight of 428.23 g/mol. Its IUPAC name is 1-methoxy-4-[[(E)-7,7,7-trifluoro-6-iodo-2-methylhept-5-en-3-yl]oxymethyl]benzene.
| Compound Name | 1-methoxy-4-[[(E)-7,7,7-trifluoro-6-iodo-2-methylhept-5-en-3-yl]oxymethyl]benzene |
|---|---|
| PubChem CID | 132503968 |
| Molecular Formula | C16H20F3IO2 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-methoxy-4-[[(E)-7,7,7-trifluoro-6-iodo-2-methylhept-5-en-3-yl]oxymethyl]benzene |
| SMILES | COc1ccc(COC(C/C=C(/I)C(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C16H20F3IO2/c1-11(2)14(8-9-15(20)16(17,18)19)22-10-12-4-6-13(21-3)7-5-12/h4-7,9,11,14H,8,10H2,1-3H3/b15-9+ |
| InChIKey | YIDXTXXODYCSBX-OQLLNIDSSA-N |
| XLogP | 5.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|