C35H50O7 — CID 24879792
(4R,5S,8S)-8-[(E,2R,3R,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,8-dimethylnon-4-en-2-yl]-4-[(4-methoxyphenyl)methoxy]-5-methyloxocan-2-one (PubChem CID 24879792) has the molecular formula C35H50O7 and a molecular weight of 582.78 g/mol. Its IUPAC name is (4R,5S,8S)-8-[(E,2R,3R,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,8-dimethylnon-4-en-2-yl]-4-[(4-methoxyphenyl)methoxy]-5-methyloxocan-2-one.
| Compound Name | (4R,5S,8S)-8-[(E,2R,3R,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,8-dimethylnon-4-en-2-yl]-4-[(4-methoxyphenyl)methoxy]-5-methyloxocan-2-one |
|---|---|
| PubChem CID | 24879792 |
| Molecular Formula | C35H50O7 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | (4R,5S,8S)-8-[(E,2R,3R,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-4,8-dimethylnon-4-en-2-yl]-4-[(4-methoxyphenyl)methoxy]-5-methyloxocan-2-one |
| SMILES | COc1ccc(CO[C@@H](C/C=C(\C)[C@H](O)[C@@H](C)[C@@H]2CC[C@H](C)[C@H](OCc3ccc(OC)cc3)CC(=O)O2)C(C)C)cc1 |
| InChI | InChI=1S/C35H50O7/c1-23(2)31(40-21-27-10-14-29(38-6)15-11-27)18-9-25(4)35(37)26(5)32-19-8-24(3)33(20-34(36)42-32)41-22-28-12-16-30(39-7)17-13-28/h9-17,23-24,26,31-33,35,37H,8,18-22H2,1-7H3/b25-9+/t24-,26-,31-,32-,33+,35-/m0/s1 |
| InChIKey | ZXERALHDGUAFRJ-UOXLZIGSSA-N |
| XLogP | 6.90 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|