C23H20NO2P — CID 132505935
(3aS,8bR)-1-diphenylphosphoryl-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one (PubChem CID 132505935) has the molecular formula C23H20NO2P and a molecular weight of 373.39 g/mol. Its IUPAC name is (3aS,8bR)-1-diphenylphosphoryl-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one.
| Compound Name | (3aS,8bR)-1-diphenylphosphoryl-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 132505935 |
| Molecular Formula | C23H20NO2P |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (3aS,8bR)-1-diphenylphosphoryl-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
| SMILES | O=C1C[C@@H]2Cc3ccccc3[C@@H]2N1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20NO2P/c25-22-16-18-15-17-9-7-8-14-21(17)23(18)24(22)27(26,19-10-3-1-4-11-19)20-12-5-2-6-13-20/h1-14,18,23H,15-16H2/t18-,23+/m0/s1 |
| InChIKey | JZYBFBJYKBQPOR-FDDCHVKYSA-N |
| XLogP | 4.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|