C24H22NO2P — CID 177439089
(3aR,9bS)-1-diphenylphosphoryl-3a,4,5,9b-tetrahydro-3H-benzo[g]indol-2-one (PubChem CID 177439089) has the molecular formula C24H22NO2P and a molecular weight of 387.42 g/mol. Its IUPAC name is (3aR,9bS)-1-diphenylphosphoryl-3a,4,5,9b-tetrahydro-3H-benzo[g]indol-2-one.
| Compound Name | (3aR,9bS)-1-diphenylphosphoryl-3a,4,5,9b-tetrahydro-3H-benzo[g]indol-2-one |
|---|---|
| PubChem CID | 177439089 |
| Molecular Formula | C24H22NO2P |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (3aR,9bS)-1-diphenylphosphoryl-3a,4,5,9b-tetrahydro-3H-benzo[g]indol-2-one |
| SMILES | O=C1C[C@H]2CCc3ccccc3[C@H]2N1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22NO2P/c26-23-17-19-16-15-18-9-7-8-14-22(18)24(19)25(23)28(27,20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-14,19,24H,15-17H2/t19-,24+/m1/s1 |
| InChIKey | XOGOLEOPQOYJNW-DVECYGJZSA-N |
| XLogP | 4.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|