C40H34N2P2 — CID 132513866
(15R,16R)-15-N,16-N-bis(diphenylphosphanyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-diamine (PubChem CID 132513866) has the molecular formula C40H34N2P2 and a molecular weight of 604.67 g/mol. Its IUPAC name is (15R,16R)-15-N,16-N-bis(diphenylphosphanyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-diamine.
| Compound Name | (15R,16R)-15-N,16-N-bis(diphenylphosphanyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-diamine |
|---|---|
| PubChem CID | 132513866 |
| Molecular Formula | C40H34N2P2 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | (15R,16R)-15-N,16-N-bis(diphenylphosphanyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-diamine |
| SMILES | c1ccc(P(N[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2NP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H34N2P2/c1-5-17-29(18-6-1)43(30-19-7-2-8-20-30)41-39-37-33-25-13-15-27-35(33)38(36-28-16-14-26-34(36)37)40(39)42-44(31-21-9-3-10-22-31)32-23-11-4-12-24-32/h1-28,37-42H/t37?,38?,39-,40-/m1/s1 |
| InChIKey | SXPRZDDIJXDWHH-HVDOYAPBSA-N |
| XLogP | 7.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|