C26H28N2O2S2 — CID 132515431
5-(4-tert-butylphenyl)-3-(4-methylphenyl)sulfonyl-N-phenyl-1,3-thiazolidin-2-imine (PubChem CID 132515431) has the molecular formula C26H28N2O2S2 and a molecular weight of 464.66 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-3-(4-methylphenyl)sulfonyl-N-phenyl-1,3-thiazolidin-2-imine.
| Compound Name | 5-(4-tert-butylphenyl)-3-(4-methylphenyl)sulfonyl-N-phenyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 132515431 |
| Molecular Formula | C26H28N2O2S2 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 5-(4-tert-butylphenyl)-3-(4-methylphenyl)sulfonyl-N-phenyl-1,3-thiazolidin-2-imine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3ccc(C(C)(C)C)cc3)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O2S2/c1-19-10-16-23(17-11-19)32(29,30)28-18-24(20-12-14-21(15-13-20)26(2,3)4)31-25(28)27-22-8-6-5-7-9-22/h5-17,24H,18H2,1-4H3/b27-25- |
| InChIKey | DKMGRUYLQZTXOK-RFBIWTDZSA-N |
| XLogP | 6.46 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|