C17H23N3O3 — CID 132517427
(3S)-2-benzyl-6-methoxy-3-methyl-3,6,7,8,9,10-hexahydro-[1,2,4]triazino[1,2-a]diazepine-1,4-dione (PubChem CID 132517427) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (3S)-2-benzyl-6-methoxy-3-methyl-3,6,7,8,9,10-hexahydro-[1,2,4]triazino[1,2-a]diazepine-1,4-dione.
| Compound Name | (3S)-2-benzyl-6-methoxy-3-methyl-3,6,7,8,9,10-hexahydro-[1,2,4]triazino[1,2-a]diazepine-1,4-dione |
|---|---|
| PubChem CID | 132517427 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (3S)-2-benzyl-6-methoxy-3-methyl-3,6,7,8,9,10-hexahydro-[1,2,4]triazino[1,2-a]diazepine-1,4-dione |
| SMILES | COC1CCCCN2C(=O)N(Cc3ccccc3)[C@@H](C)C(=O)N12 |
| InChI | InChI=1S/C17H23N3O3/c1-13-16(21)20-15(23-2)10-6-7-11-19(20)17(22)18(13)12-14-8-4-3-5-9-14/h3-5,8-9,13,15H,6-7,10-12H2,1-2H3/t13-,15?/m0/s1 |
| InChIKey | OLLXXEBJEFIXDH-CFMCSPIPSA-N |
| XLogP | 2.21 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |