C29H32BrNO5S — CID 132521812
tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(4-bromophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate (PubChem CID 132521812) has the molecular formula C29H32BrNO5S and a molecular weight of 586.55 g/mol. Its IUPAC name is tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(4-bromophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(4-bromophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 132521812 |
| Molecular Formula | C29H32BrNO5S |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(4-bromophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
| SMILES | CC(=O)[C@@]12C=CC=CC[C@@H]1[C@@H](C(=O)OC(C)(C)C)N(S(=O)(=O)c1ccc(C)cc1)[C@H]2c1ccc(Br)cc1 |
| InChI | InChI=1S/C29H32BrNO5S/c1-19-10-16-23(17-11-19)37(34,35)31-25(27(33)36-28(3,4)5)24-9-7-6-8-18-29(24,20(2)32)26(31)21-12-14-22(30)15-13-21/h6-8,10-18,24-26H,9H2,1-5H3/t24-,25+,26+,29+/m1/s1 |
| InChIKey | JCQBBEHFOUWIFF-NVGWLYTESA-N |
| XLogP | 5.92 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |