C33H35NO5S — CID 132521822
tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-2-(4-methylphenyl)sulfonyl-3-naphthalen-1-yl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate (PubChem CID 132521822) has the molecular formula C33H35NO5S and a molecular weight of 557.71 g/mol. Its IUPAC name is tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-2-(4-methylphenyl)sulfonyl-3-naphthalen-1-yl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-2-(4-methylphenyl)sulfonyl-3-naphthalen-1-yl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 132521822 |
| Molecular Formula | C33H35NO5S |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-2-(4-methylphenyl)sulfonyl-3-naphthalen-1-yl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
| SMILES | CC(=O)[C@@]12C=CC=CC[C@@H]1[C@@H](C(=O)OC(C)(C)C)N(S(=O)(=O)c1ccc(C)cc1)[C@H]2c1cccc2ccccc12 |
| InChI | InChI=1S/C33H35NO5S/c1-22-17-19-25(20-18-22)40(37,38)34-29(31(36)39-32(3,4)5)28-16-7-6-10-21-33(28,23(2)35)30(34)27-15-11-13-24-12-8-9-14-26(24)27/h6-15,17-21,28-30H,16H2,1-5H3/t28-,29+,30+,33+/m1/s1 |
| InChIKey | WIUGJNGBWXFDND-XHKFQDSHSA-N |
| XLogP | 6.31 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |