C30H32N2O5S — CID 132521815
tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(4-cyanophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate (PubChem CID 132521815) has the molecular formula C30H32N2O5S and a molecular weight of 532.66 g/mol. Its IUPAC name is tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(4-cyanophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(4-cyanophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 132521815 |
| Molecular Formula | C30H32N2O5S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | tert-butyl (1S,3S,3aS,8aS)-3a-acetyl-3-(4-cyanophenyl)-2-(4-methylphenyl)sulfonyl-1,3,8,8a-tetrahydrocyclohepta[c]pyrrole-1-carboxylate |
| SMILES | CC(=O)[C@@]12C=CC=CC[C@@H]1[C@@H](C(=O)OC(C)(C)C)N(S(=O)(=O)c1ccc(C)cc1)[C@H]2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C30H32N2O5S/c1-20-10-16-24(17-11-20)38(35,36)32-26(28(34)37-29(3,4)5)25-9-7-6-8-18-30(25,21(2)33)27(32)23-14-12-22(19-31)13-15-23/h6-8,10-18,25-27H,9H2,1-5H3/t25-,26+,27+,30+/m1/s1 |
| InChIKey | TXOMAVGALOVHOL-VEAWFHDZSA-N |
| XLogP | 5.03 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |