C25H29NO5S — CID 100801014
ethyl (2S,3R,3aS,8aR)-1-(4-methylphenyl)sulfonyl-4-oxo-3-phenyl-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate (PubChem CID 100801014) has the molecular formula C25H29NO5S and a molecular weight of 455.58 g/mol. Its IUPAC name is ethyl (2S,3R,3aS,8aR)-1-(4-methylphenyl)sulfonyl-4-oxo-3-phenyl-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate.
| Compound Name | ethyl (2S,3R,3aS,8aR)-1-(4-methylphenyl)sulfonyl-4-oxo-3-phenyl-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 100801014 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | ethyl (2S,3R,3aS,8aR)-1-(4-methylphenyl)sulfonyl-4-oxo-3-phenyl-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccccc2)[C@@H]2C(=O)CCCC[C@H]2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H29NO5S/c1-3-31-25(28)24-22(18-9-5-4-6-10-18)23-20(11-7-8-12-21(23)27)26(24)32(29,30)19-15-13-17(2)14-16-19/h4-6,9-10,13-16,20,22-24H,3,7-8,11-12H2,1-2H3/t20-,22+,23+,24+/m1/s1 |
| InChIKey | FOXBAFUITBYEIA-KAMZKSLDSA-N |
| XLogP | 3.84 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |