C23H31NO2 — CID 132529828
(1S,2R,5R,7R,10S,11S,14E,15S)-14-(4,5-dihydro-1,3-oxazol-2-ylmethylidene)-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecan-8-one (PubChem CID 132529828) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (1S,2R,5R,7R,10S,11S,14E,15S)-14-(4,5-dihydro-1,3-oxazol-2-ylmethylidene)-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecan-8-one.
| Compound Name | (1S,2R,5R,7R,10S,11S,14E,15S)-14-(4,5-dihydro-1,3-oxazol-2-ylmethylidene)-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecan-8-one |
|---|---|
| PubChem CID | 132529828 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (1S,2R,5R,7R,10S,11S,14E,15S)-14-(4,5-dihydro-1,3-oxazol-2-ylmethylidene)-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadecan-8-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC(=O)[C@]45C[C@H]4CC[C@]35C)[C@@H]1CC/C2=C\C1=NCCO1 |
| InChI | InChI=1S/C23H31NO2/c1-21-7-6-18-16(12-19(25)23-13-15(23)5-8-22(18,23)2)17(21)4-3-14(21)11-20-24-9-10-26-20/h11,15-18H,3-10,12-13H2,1-2H3/b14-11+/t15-,16+,17+,18+,21-,22-,23+/m1/s1 |
| InChIKey | AEIQLMGIBVOWQZ-GOWMTVLOSA-N |
| XLogP | 4.56 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |