C22H33NO — CID 99576137
(1R,2S,5S,6S,9R,12S,13R,16R,18S)-6,7,13-trimethyl-7-azahexacyclo[10.8.0.02,9.05,9.013,18.016,18]icosan-19-one (PubChem CID 99576137) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is (1R,2S,5S,6S,9R,12S,13R,16R,18S)-6,7,13-trimethyl-7-azahexacyclo[10.8.0.02,9.05,9.013,18.016,18]icosan-19-one.
| Compound Name | (1R,2S,5S,6S,9R,12S,13R,16R,18S)-6,7,13-trimethyl-7-azahexacyclo[10.8.0.02,9.05,9.013,18.016,18]icosan-19-one |
|---|---|
| PubChem CID | 99576137 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (1R,2S,5S,6S,9R,12S,13R,16R,18S)-6,7,13-trimethyl-7-azahexacyclo[10.8.0.02,9.05,9.013,18.016,18]icosan-19-one |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC(=O)[C@@]56C[C@H]5CC[C@]6(C)[C@H]4CC[C@]23CN1C |
| InChI | InChI=1S/C22H33NO/c1-13-16-4-5-18-15-10-19(24)22-11-14(22)6-8-20(22,2)17(15)7-9-21(16,18)12-23(13)3/h13-18H,4-12H2,1-3H3/t13-,14+,15+,16+,17-,18-,20+,21-,22+/m0/s1 |
| InChIKey | PBPLSRQRDBOFMK-YVCXWCFRSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |