C25H24F2O3Si — CID 132535376
(4R)-4-[bis(4-fluorophenyl)-trimethylsilyloxymethyl]-3,4-dihydrochromen-2-one (PubChem CID 132535376) has the molecular formula C25H24F2O3Si and a molecular weight of 438.55 g/mol. Its IUPAC name is (4R)-4-[bis(4-fluorophenyl)-trimethylsilyloxymethyl]-3,4-dihydrochromen-2-one.
| Compound Name | (4R)-4-[bis(4-fluorophenyl)-trimethylsilyloxymethyl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 132535376 |
| Molecular Formula | C25H24F2O3Si |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (4R)-4-[bis(4-fluorophenyl)-trimethylsilyloxymethyl]-3,4-dihydrochromen-2-one |
| SMILES | C[Si](C)(C)OC(c1ccc(F)cc1)(c1ccc(F)cc1)[C@@H]1CC(=O)Oc2ccccc21 |
| InChI | InChI=1S/C25H24F2O3Si/c1-31(2,3)30-25(17-8-12-19(26)13-9-17,18-10-14-20(27)15-11-18)22-16-24(28)29-23-7-5-4-6-21(22)23/h4-15,22H,16H2,1-3H3/t22-/m1/s1 |
| InChIKey | RBKNPPDZDGZHPZ-JOCHJYFZSA-N |
| XLogP | 6.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|