C37H31N3O6S — CID 132536185
(2S,4S,5R)-1'-benzyl-2-(4-methylphenyl)-3-(4-methylphenyl)sulfonyl-4-(4-nitrophenyl)spiro[1,3-oxazolidine-5,3'-indole]-2'-one (PubChem CID 132536185) has the molecular formula C37H31N3O6S and a molecular weight of 645.74 g/mol. Its IUPAC name is (2S,4S,5R)-1'-benzyl-2-(4-methylphenyl)-3-(4-methylphenyl)sulfonyl-4-(4-nitrophenyl)spiro[1,3-oxazolidine-5,3'-indole]-2'-one.
| Compound Name | (2S,4S,5R)-1'-benzyl-2-(4-methylphenyl)-3-(4-methylphenyl)sulfonyl-4-(4-nitrophenyl)spiro[1,3-oxazolidine-5,3'-indole]-2'-one |
|---|---|
| PubChem CID | 132536185 |
| Molecular Formula | C37H31N3O6S |
| Molecular Weight | 645.74 g/mol |
| Exact Mass | 645.19 |
| IUPAC Name | (2S,4S,5R)-1'-benzyl-2-(4-methylphenyl)-3-(4-methylphenyl)sulfonyl-4-(4-nitrophenyl)spiro[1,3-oxazolidine-5,3'-indole]-2'-one |
| SMILES | Cc1ccc([C@@H]2O[C@@]3(C(=O)N(Cc4ccccc4)c4ccccc43)[C@H](c3ccc([N+](=O)[O-])cc3)N2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C37H31N3O6S/c1-25-12-16-29(17-13-25)35-39(47(44,45)31-22-14-26(2)15-23-31)34(28-18-20-30(21-19-28)40(42)43)37(46-35)32-10-6-7-11-33(32)38(36(37)41)24-27-8-4-3-5-9-27/h3-23,34-35H,24H2,1-2H3/t34-,35-,37+/m0/s1 |
| InChIKey | ZOSZQZDEZDSQQL-VUNSNMIUSA-N |
| XLogP | 7.11 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.74 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|