C30H27N3O8 — CID 139040977
dimethyl (2R,4R)-3-(4-methylphenyl)-2-(4-nitrophenyl)-2'-oxo-1'-prop-2-enylspiro[1,3-oxazolidine-4,3'-indole]-5,5-dicarboxylate (PubChem CID 139040977) has the molecular formula C30H27N3O8 and a molecular weight of 557.56 g/mol. Its IUPAC name is dimethyl (2R,4R)-3-(4-methylphenyl)-2-(4-nitrophenyl)-2'-oxo-1'-prop-2-enylspiro[1,3-oxazolidine-4,3'-indole]-5,5-dicarboxylate.
| Compound Name | dimethyl (2R,4R)-3-(4-methylphenyl)-2-(4-nitrophenyl)-2'-oxo-1'-prop-2-enylspiro[1,3-oxazolidine-4,3'-indole]-5,5-dicarboxylate |
|---|---|
| PubChem CID | 139040977 |
| Molecular Formula | C30H27N3O8 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | dimethyl (2R,4R)-3-(4-methylphenyl)-2-(4-nitrophenyl)-2'-oxo-1'-prop-2-enylspiro[1,3-oxazolidine-4,3'-indole]-5,5-dicarboxylate |
| SMILES | C=CCN1C(=O)[C@]2(c3ccccc31)N(c1ccc(C)cc1)[C@@H](c1ccc([N+](=O)[O-])cc1)OC2(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C30H27N3O8/c1-5-18-31-24-9-7-6-8-23(24)29(26(31)34)30(27(35)39-3,28(36)40-4)41-25(20-12-16-22(17-13-20)33(37)38)32(29)21-14-10-19(2)11-15-21/h5-17,25H,1,18H2,2-4H3/t25-,29+/m1/s1 |
| InChIKey | HMDOCRWHJACLSL-IRPSRAIASA-N |
| XLogP | 3.95 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|