C31H29N3O5S — CID 10721509
methyl (2S,4R,5R)-4-benzyl-1-[(S)-(4-methylphenyl)sulfinyl]-5-(4-nitrophenyl)-2-phenylimidazolidine-4-carboxylate (PubChem CID 10721509) has the molecular formula C31H29N3O5S and a molecular weight of 555.66 g/mol. Its IUPAC name is methyl (2S,4R,5R)-4-benzyl-1-[(S)-(4-methylphenyl)sulfinyl]-5-(4-nitrophenyl)-2-phenylimidazolidine-4-carboxylate.
| Compound Name | methyl (2S,4R,5R)-4-benzyl-1-[(S)-(4-methylphenyl)sulfinyl]-5-(4-nitrophenyl)-2-phenylimidazolidine-4-carboxylate |
|---|---|
| PubChem CID | 10721509 |
| Molecular Formula | C31H29N3O5S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | methyl (2S,4R,5R)-4-benzyl-1-[(S)-(4-methylphenyl)sulfinyl]-5-(4-nitrophenyl)-2-phenylimidazolidine-4-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccccc2)N[C@H](c2ccccc2)N([S@@](=O)c2ccc(C)cc2)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H29N3O5S/c1-22-13-19-27(20-14-22)40(38)33-28(24-15-17-26(18-16-24)34(36)37)31(30(35)39-2,21-23-9-5-3-6-10-23)32-29(33)25-11-7-4-8-12-25/h3-20,28-29,32H,21H2,1-2H3/t28-,29+,31-,40+/m1/s1 |
| InChIKey | YRKJPDGAUYXVCR-ZOFUUPLRSA-N |
| XLogP | 5.43 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|