C19H23N2O6PS — CID 101014868
(2R,3R)-2-diethoxyphosphoryl-1-(4-methylphenyl)sulfinyl-3-(3-nitrophenyl)aziridine (PubChem CID 101014868) has the molecular formula C19H23N2O6PS and a molecular weight of 438.44 g/mol. Its IUPAC name is (2R,3R)-2-diethoxyphosphoryl-1-(4-methylphenyl)sulfinyl-3-(3-nitrophenyl)aziridine.
| Compound Name | (2R,3R)-2-diethoxyphosphoryl-1-(4-methylphenyl)sulfinyl-3-(3-nitrophenyl)aziridine |
|---|---|
| PubChem CID | 101014868 |
| Molecular Formula | C19H23N2O6PS |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (2R,3R)-2-diethoxyphosphoryl-1-(4-methylphenyl)sulfinyl-3-(3-nitrophenyl)aziridine |
| SMILES | CCOP(=O)(OCC)[C@@H]1[C@@H](c2cccc([N+](=O)[O-])c2)N1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23N2O6PS/c1-4-26-28(24,27-5-2)19-18(15-7-6-8-16(13-15)21(22)23)20(19)29(25)17-11-9-14(3)10-12-17/h6-13,18-19H,4-5H2,1-3H3/t18-,19-,20?,29?/m1/s1 |
| InChIKey | MELVBJKOMXDHGI-QQLUBOKKSA-N |
| XLogP | 4.57 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|