C21H17NO5 — CID 132538325
[(E)-5-(1,3-dioxoisoindol-2-yl)-1-oxo-1-phenylpent-2-en-2-yl] acetate (PubChem CID 132538325) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is [(E)-5-(1,3-dioxoisoindol-2-yl)-1-oxo-1-phenylpent-2-en-2-yl] acetate.
| Compound Name | [(E)-5-(1,3-dioxoisoindol-2-yl)-1-oxo-1-phenylpent-2-en-2-yl] acetate |
|---|---|
| PubChem CID | 132538325 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [(E)-5-(1,3-dioxoisoindol-2-yl)-1-oxo-1-phenylpent-2-en-2-yl] acetate |
| SMILES | CC(=O)O/C(=C/CCN1C(=O)c2ccccc2C1=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17NO5/c1-14(23)27-18(19(24)15-8-3-2-4-9-15)12-7-13-22-20(25)16-10-5-6-11-17(16)21(22)26/h2-6,8-12H,7,13H2,1H3/b18-12+ |
| InChIKey | XFDCWTIKAZICFL-LDADJPATSA-N |
| XLogP | 3.00 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|