C28H12F12IN3 — CID 132538511
N-[2,4-bis(trifluoromethyl)quinolin-7-yl]-N-(4-iodophenyl)-2,4-bis(trifluoromethyl)quinolin-7-amine (PubChem CID 132538511) has the molecular formula C28H12F12IN3 and a molecular weight of 745.30 g/mol. Its IUPAC name is N-[2,4-bis(trifluoromethyl)quinolin-7-yl]-N-(4-iodophenyl)-2,4-bis(trifluoromethyl)quinolin-7-amine.
| Compound Name | N-[2,4-bis(trifluoromethyl)quinolin-7-yl]-N-(4-iodophenyl)-2,4-bis(trifluoromethyl)quinolin-7-amine |
|---|---|
| PubChem CID | 132538511 |
| Molecular Formula | C28H12F12IN3 |
| Molecular Weight | 745.30 g/mol |
| Exact Mass | 744.99 |
| IUPAC Name | N-[2,4-bis(trifluoromethyl)quinolin-7-yl]-N-(4-iodophenyl)-2,4-bis(trifluoromethyl)quinolin-7-amine |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c2ccc(N(c3ccc(I)cc3)c3ccc4c(C(F)(F)F)cc(C(F)(F)F)nc4c3)cc2n1 |
| InChI | InChI=1S/C28H12F12IN3/c29-25(30,31)19-11-23(27(35,36)37)42-21-9-15(5-7-17(19)21)44(14-3-1-13(41)2-4-14)16-6-8-18-20(26(32,33)34)12-24(28(38,39)40)43-22(18)10-16/h1-12H |
| InChIKey | CIIPXWXTBNMOCO-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.30 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|