C26H46N3P — CID 132546445
N-ditert-butylphosphanyl-N'-[2,6-di(propan-2-yl)phenyl]piperidine-1-carboximidamide (PubChem CID 132546445) has the molecular formula C26H46N3P and a molecular weight of 431.65 g/mol. Its IUPAC name is N-ditert-butylphosphanyl-N'-[2,6-di(propan-2-yl)phenyl]piperidine-1-carboximidamide.
| Compound Name | N-ditert-butylphosphanyl-N'-[2,6-di(propan-2-yl)phenyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 132546445 |
| Molecular Formula | C26H46N3P |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | N-ditert-butylphosphanyl-N'-[2,6-di(propan-2-yl)phenyl]piperidine-1-carboximidamide |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\NP(C(C)(C)C)C(C)(C)C)N1CCCCC1 |
| InChI | InChI=1S/C26H46N3P/c1-19(2)21-15-14-16-22(20(3)4)23(21)27-24(29-17-12-11-13-18-29)28-30(25(5,6)7)26(8,9)10/h14-16,19-20H,11-13,17-18H2,1-10H3,(H,27,28) |
| InChIKey | PTEYJJOFPYZJQX-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|